C24H18ClF6N3O — CID 118431775
2-[3-[4-(3-aminophenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431775) has the molecular formula C24H18ClF6N3O and a molecular weight of 513.87 g/mol. Its IUPAC name is 2-[3-[4-(3-aminophenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-[4-(3-aminophenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431775 |
| Molecular Formula | C24H18ClF6N3O |
| Molecular Weight | 513.87 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 2-[3-[4-(3-aminophenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1cccc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C24H18ClF6N3O/c25-18-6-1-2-7-19(18)34-20(13-21(33-34)22(35,23(26,27)28)24(29,30)31)15-10-8-14(9-11-15)16-4-3-5-17(32)12-16/h1-12,20,35H,13,32H2 |
| InChIKey | UICNHGAFAGABKY-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.87 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|