C22H22Cl2F6N4O — CID 118431806
2-[3-(2-chlorophenyl)-2-(3-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride (PubChem CID 118431806) has the molecular formula C22H22Cl2F6N4O and a molecular weight of 543.34 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-2-(3-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride.
| Compound Name | 2-[3-(2-chlorophenyl)-2-(3-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 118431806 |
| Molecular Formula | C22H22Cl2F6N4O |
| Molecular Weight | 543.34 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-2-(3-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
| SMILES | Cl.OC(C1=NN(c2cccc(N3CCNCC3)c2)C(c2ccccc2Cl)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H21ClF6N4O.ClH/c23-17-7-2-1-6-16(17)18-13-19(20(34,21(24,25)26)22(27,28)29)31-33(18)15-5-3-4-14(12-15)32-10-8-30-9-11-32;/h1-7,12,18,30,34H,8-11,13H2;1H |
| InChIKey | RTJGZIATVDLAMT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |