C22H20ClF6N3O3S2 — CID 118431823
2-[2-(2-chlorophenyl)-3-[5-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431823) has the molecular formula C22H20ClF6N3O3S2 and a molecular weight of 588.00 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[5-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[5-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431823 |
| Molecular Formula | C22H20ClF6N3O3S2 |
| Molecular Weight | 588.00 g/mol |
| Exact Mass | 587.05 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[5-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CS(=O)(=O)N1CC=C(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)s2)CC1 |
| InChI | InChI=1S/C22H20ClF6N3O3S2/c1-37(34,35)31-10-8-13(9-11-31)17-6-7-18(36-17)16-12-19(20(33,21(24,25)26)22(27,28)29)30-32(16)15-5-3-2-4-14(15)23/h2-8,16,33H,9-12H2,1H3 |
| InChIKey | MXVUFXYXQATTIW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |