C27H29ClF6N4O3 — CID 118431826
tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate (PubChem CID 118431826) has the molecular formula C27H29ClF6N4O3 and a molecular weight of 607.00 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118431826 |
| Molecular Formula | C27H29ClF6N4O3 |
| Molecular Weight | 607.00 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C27H29ClF6N4O3/c1-24(2,3)41-23(39)37-14-12-36(13-15-37)18-10-8-17(9-11-18)21-16-22(25(40,26(29,30)31)27(32,33)34)35-38(21)20-7-5-4-6-19(20)28/h4-11,21,40H,12-16H2,1-3H3 |
| InChIKey | XFEYLMINGYBDKJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.00 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|