C23H20F7N3O2S — CID 118431886
4-[3-[3-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-2-yl]phenyl]-1-methylsulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 118431886) has the molecular formula C23H20F7N3O2S and a molecular weight of 535.49 g/mol. Its IUPAC name is 4-[3-[3-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-2-yl]phenyl]-1-methylsulfonyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-[3-[3-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-2-yl]phenyl]-1-methylsulfonyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 118431886 |
| Molecular Formula | C23H20F7N3O2S |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 4-[3-[3-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-2-yl]phenyl]-1-methylsulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | CS(=O)(=O)N1CC=C(c2cccc(N3N=C(C(F)(F)C(F)(F)F)CC3c3ccc(F)cc3F)c2)CC1 |
| InChI | InChI=1S/C23H20F7N3O2S/c1-36(34,35)32-9-7-14(8-10-32)15-3-2-4-17(11-15)33-20(18-6-5-16(24)12-19(18)25)13-21(31-33)22(26,27)23(28,29)30/h2-7,11-12,20H,8-10,13H2,1H3 |
| InChIKey | FDDGZBQWNWJSFF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|