C26H20ClF7N2O2 — CID 118431950
2-[2-(2-chlorophenyl)-3-[4-(3-ethoxyphenyl)-2-fluorophenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431950) has the molecular formula C26H20ClF7N2O2 and a molecular weight of 560.90 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(3-ethoxyphenyl)-2-fluorophenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(3-ethoxyphenyl)-2-fluorophenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431950 |
| Molecular Formula | C26H20ClF7N2O2 |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(3-ethoxyphenyl)-2-fluorophenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCOc1cccc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)c(F)c2)c1 |
| InChI | InChI=1S/C26H20ClF7N2O2/c1-2-38-17-7-5-6-15(12-17)16-10-11-18(20(28)13-16)22-14-23(24(37,25(29,30)31)26(32,33)34)35-36(22)21-9-4-3-8-19(21)27/h3-13,22,37H,2,14H2,1H3 |
| InChIKey | VXNCBMBXLRIPJY-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |