C22H21ClF8N4O — CID 118431989
2-[2-(2,4-difluorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride (PubChem CID 118431989) has the molecular formula C22H21ClF8N4O and a molecular weight of 544.87 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride.
| Compound Name | 2-[2-(2,4-difluorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 118431989 |
| Molecular Formula | C22H21ClF8N4O |
| Molecular Weight | 544.87 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
| SMILES | Cl.OC(C1=NN(c2ccc(F)cc2F)C(c2ccc(N3CCNCC3)cc2)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H20F8N4O.ClH/c23-14-3-6-17(16(24)11-14)34-18(12-19(32-34)20(35,21(25,26)27)22(28,29)30)13-1-4-15(5-2-13)33-9-7-31-8-10-33;/h1-6,11,18,31,35H,7-10,12H2;1H |
| InChIKey | WQENBPPEJINEAL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|