C23H17ClF6N4O2 — CID 118432093
2-[2-(2-chlorophenyl)-3-[4-(2-methoxypyrimidin-5-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118432093) has the molecular formula C23H17ClF6N4O2 and a molecular weight of 530.86 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(2-methoxypyrimidin-5-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(2-methoxypyrimidin-5-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118432093 |
| Molecular Formula | C23H17ClF6N4O2 |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(2-methoxypyrimidin-5-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | COc1ncc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)cn1 |
| InChI | InChI=1S/C23H17ClF6N4O2/c1-36-20-31-11-15(12-32-20)13-6-8-14(9-7-13)18-10-19(21(35,22(25,26)27)23(28,29)30)33-34(18)17-5-3-2-4-16(17)24/h2-9,11-12,18,35H,10H2,1H3 |
| InChIKey | MYSHHPSYKMSVCR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |