C23H15ClF7N3O — CID 118432119
2-[2-(2-chlorophenyl)-3-[4-(6-fluoro-3-pyridinyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118432119) has the molecular formula C23H15ClF7N3O and a molecular weight of 517.83 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(6-fluoro-3-pyridinyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(6-fluoro-3-pyridinyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118432119 |
| Molecular Formula | C23H15ClF7N3O |
| Molecular Weight | 517.83 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(6-fluoro-3-pyridinyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1=NN(c2ccccc2Cl)C(c2ccc(-c3ccc(F)nc3)cc2)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H15ClF7N3O/c24-16-3-1-2-4-17(16)34-18(11-19(33-34)21(35,22(26,27)28)23(29,30)31)14-7-5-13(6-8-14)15-9-10-20(25)32-12-15/h1-10,12,18,35H,11H2 |
| InChIKey | CPSMKDUHRBEHKX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.83 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|