About 2-(hydroxymethyl)-2-methylpropane-1,3-diol
2-(hydroxymethyl)-2-methylpropane-1,3-diol (PubChem CID 118432348) has the molecular formula C15H36O9
and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-methylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2-methylpropane-1,3-diol |
| PubChem CID | 118432348 |
| Molecular Formula | C15H36O9 |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 2-(hydroxymethyl)-2-methylpropane-1,3-diol |
| SMILES | CC(CO)(CO)CO.CC(CO)(CO)CO.CC(CO)(CO)CO |
| InChI | InChI=1S/3C5H12O3/c3*1-5(2-6,3-7)4-8/h3*6-8H,2-4H2,1H3 |
| InChIKey | LBLDNXBPKZOFJQ-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(hydroxymethyl)-2-methylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2-methylpropane-1,3-diol?
The IUPAC name of 2-(hydroxymethyl)-2-methylpropane-1,3-diol (CID 118432348) is 2-(hydroxymethyl)-2-methylpropane-1,3-diol.
What is the SMILES notation for 2-(hydroxymethyl)-2-methylpropane-1,3-diol?
The canonical SMILES for 2-(hydroxymethyl)-2-methylpropane-1,3-diol is CC(CO)(CO)CO.CC(CO)(CO)CO.CC(CO)(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)-2-methylpropane-1,3-diol?
The InChIKey is LBLDNXBPKZOFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C5H12O3/c3*1-5(2-6,3-7)4-8/h3*6-8H,2-4H2,1H3.
What are the key properties of 2-(hydroxymethyl)-2-methylpropane-1,3-diol?
2-(hydroxymethyl)-2-methylpropane-1,3-diol has a molecular weight of 360.44 g/mol, XLogP of -3.09, 9 rotatable bonds, 9 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2-methylpropane-1,3-diol is sourced from PubChem (CID 118432348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).