C26H27NO3 — CID 118432349
methyl 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoate (PubChem CID 118432349) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 118432349 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | methyl 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2C(=O)OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO3/c1-3-4-14-25(28)27(22-10-6-5-7-11-22)19-20-15-17-21(18-16-20)23-12-8-9-13-24(23)26(29)30-2/h5-13,15-18H,3-4,14,19H2,1-2H3 |
| InChIKey | BCWFKCJJQDOIOO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |