C9H15NO3 — CID 118432396
(4R,5R)-5-but-3-en-2-yl-4-(2-hydroxyethyl)-1,3-oxazolidin-2-one (PubChem CID 118432396) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (4R,5R)-5-but-3-en-2-yl-4-(2-hydroxyethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-5-but-3-en-2-yl-4-(2-hydroxyethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118432396 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (4R,5R)-5-but-3-en-2-yl-4-(2-hydroxyethyl)-1,3-oxazolidin-2-one |
| SMILES | C=CC(C)[C@H]1OC(=O)N[C@@H]1CCO |
| InChI | InChI=1S/C9H15NO3/c1-3-6(2)8-7(4-5-11)10-9(12)13-8/h3,6-8,11H,1,4-5H2,2H3,(H,10,12)/t6?,7-,8-/m1/s1 |
| InChIKey | KQTZBAQZVLWAHW-SPDVFEMOSA-N |
| XLogP | 0.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|