About 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane
6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane (PubChem CID 118432407) has the molecular formula C20H20ClF3O3S
and a molecular weight of 432.89 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| PubChem CID | 118432407 |
| Molecular Formula | C20H20ClF3O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| SMILES | CC1(C)CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C20H20ClF3O3S/c1-19(2)12-17(11-18(27-19)13-6-8-15(21)9-7-13)28(25,26)16-5-3-4-14(10-16)20(22,23)24/h3-10,17-18H,11-12H2,1-2H3 |
| InChIKey | FJWIEBFKQOFQOJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane?
The IUPAC name of 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane (CID 118432407) is 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane.
What is the SMILES notation for 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane?
The canonical SMILES for 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane is CC1(C)CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC(c2ccc(Cl)cc2)O1.
What is the InChIKey of 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane?
The InChIKey is FJWIEBFKQOFQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClF3O3S/c1-19(2)12-17(11-18(27-19)13-6-8-15(21)9-7-13)28(25,26)16-5-3-4-14(10-16)20(22,23)24/h3-10,17-18H,11-12H2,1-2H3.
What are the key properties of 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane?
6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane has a molecular weight of 432.89 g/mol, XLogP of 5.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane is sourced from PubChem (CID 118432407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).