C17H24N2OS — CID 118432933
N-cyclopentyl-5-[2-(cyclopropylmethylamino)cyclopropyl]thiophene-3-carboxamide (PubChem CID 118432933) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-cyclopentyl-5-[2-(cyclopropylmethylamino)cyclopropyl]thiophene-3-carboxamide.
| Compound Name | N-cyclopentyl-5-[2-(cyclopropylmethylamino)cyclopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 118432933 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-cyclopentyl-5-[2-(cyclopropylmethylamino)cyclopropyl]thiophene-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1csc(C2CC2NCC2CC2)c1 |
| InChI | InChI=1S/C17H24N2OS/c20-17(19-13-3-1-2-4-13)12-7-16(21-10-12)14-8-15(14)18-9-11-5-6-11/h7,10-11,13-15,18H,1-6,8-9H2,(H,19,20) |
| InChIKey | YNTOCADTFBCHJY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |