C18H16O5S — CID 11843296
7-(benzenesulfonylmethoxy)-3,4-dimethylchromen-2-one (PubChem CID 11843296) has the molecular formula C18H16O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is 7-(benzenesulfonylmethoxy)-3,4-dimethylchromen-2-one.
| Compound Name | 7-(benzenesulfonylmethoxy)-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 11843296 |
| Molecular Formula | C18H16O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 7-(benzenesulfonylmethoxy)-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCS(=O)(=O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C18H16O5S/c1-12-13(2)18(19)23-17-10-14(8-9-16(12)17)22-11-24(20,21)15-6-4-3-5-7-15/h3-10H,11H2,1-2H3 |
| InChIKey | QZLSHZWLKYYRRP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|