C7H16NO7P — CID 118433475
[(3R,5R)-6-[formyl(hydroxy)amino]-3,5-dihydroxyhexyl]phosphonic acid (PubChem CID 118433475) has the molecular formula C7H16NO7P and a molecular weight of 257.18 g/mol. Its IUPAC name is [(3R,5R)-6-[formyl(hydroxy)amino]-3,5-dihydroxyhexyl]phosphonic acid.
| Compound Name | [(3R,5R)-6-[formyl(hydroxy)amino]-3,5-dihydroxyhexyl]phosphonic acid |
|---|---|
| PubChem CID | 118433475 |
| Molecular Formula | C7H16NO7P |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | [(3R,5R)-6-[formyl(hydroxy)amino]-3,5-dihydroxyhexyl]phosphonic acid |
| SMILES | O=CN(O)C[C@H](O)C[C@@H](O)CCP(=O)(O)O |
| InChI | InChI=1S/C7H16NO7P/c9-5-8(12)4-7(11)3-6(10)1-2-16(13,14)15/h5-7,10-12H,1-4H2,(H2,13,14,15)/t6-,7+/m0/s1 |
| InChIKey | GOVMEJHTXIFUEW-NKWVEPMBSA-N |
| XLogP | -1.49 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|