C34H35NO6 — CID 118433508
N-[(2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)pentyl]-N-phenylmethoxyformamide (PubChem CID 118433508) has the molecular formula C34H35NO6 and a molecular weight of 553.66 g/mol. Its IUPAC name is N-[(2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)pentyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)pentyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 118433508 |
| Molecular Formula | C34H35NO6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | N-[(2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)pentyl]-N-phenylmethoxyformamide |
| SMILES | O=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](CN(C=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H35NO6/c36-22-33(39-24-29-15-7-2-8-16-29)34(40-25-30-17-9-3-10-18-30)32(38-23-28-13-5-1-6-14-28)21-35(27-37)41-26-31-19-11-4-12-20-31/h1-20,22,27,32-34H,21,23-26H2/t32-,33-,34-/m1/s1 |
| InChIKey | VUHKZWZRZOTFDL-CKOYEXALSA-N |
| XLogP | 5.53 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|