C23H19F2N5O2 — CID 118433825
2-(1-amino-3-phenylmethoxypropyl)-3-(3,5-difluorophenyl)-4-oxopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile (PubChem CID 118433825) has the molecular formula C23H19F2N5O2 and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-(1-amino-3-phenylmethoxypropyl)-3-(3,5-difluorophenyl)-4-oxopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile.
| Compound Name | 2-(1-amino-3-phenylmethoxypropyl)-3-(3,5-difluorophenyl)-4-oxopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
|---|---|
| PubChem CID | 118433825 |
| Molecular Formula | C23H19F2N5O2 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-(1-amino-3-phenylmethoxypropyl)-3-(3,5-difluorophenyl)-4-oxopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
| SMILES | N#Cc1ccn2nc(C(N)CCOCc3ccccc3)n(-c3cc(F)cc(F)c3)c(=O)c12 |
| InChI | InChI=1S/C23H19F2N5O2/c24-17-10-18(25)12-19(11-17)30-22(28-29-8-6-16(13-26)21(29)23(30)31)20(27)7-9-32-14-15-4-2-1-3-5-15/h1-6,8,10-12,20H,7,9,14,27H2 |
| InChIKey | MJJCLNBOOWGSTG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|