C32H36Cl2N4O6 — CID 118433948
(4R,7R,10S,15E)-4-(3-chloro-4-hydroxyphenyl)-7-[(2-chloro-1H-indol-3-yl)methyl]-8,10,15-trimethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone (PubChem CID 118433948) has the molecular formula C32H36Cl2N4O6 and a molecular weight of 643.57 g/mol. Its IUPAC name is (4R,7R,10S,15E)-4-(3-chloro-4-hydroxyphenyl)-7-[(2-chloro-1H-indol-3-yl)methyl]-8,10,15-trimethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone.
| Compound Name | (4R,7R,10S,15E)-4-(3-chloro-4-hydroxyphenyl)-7-[(2-chloro-1H-indol-3-yl)methyl]-8,10,15-trimethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone |
|---|---|
| PubChem CID | 118433948 |
| Molecular Formula | C32H36Cl2N4O6 |
| Molecular Weight | 643.57 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | (4R,7R,10S,15E)-4-(3-chloro-4-hydroxyphenyl)-7-[(2-chloro-1H-indol-3-yl)methyl]-8,10,15-trimethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone |
| SMILES | C/C1=C\CCOC(=O)C[C@H](c2ccc(O)c(Cl)c2)NC(=O)[C@@H](Cc2c(Cl)[nH]c3ccccc23)N(C)C(=O)[C@H](C)NC(=O)CC1 |
| InChI | InChI=1S/C32H36Cl2N4O6/c1-18-7-6-14-44-29(41)17-25(20-11-12-27(39)23(33)15-20)37-31(42)26(38(3)32(43)19(2)35-28(40)13-10-18)16-22-21-8-4-5-9-24(21)36-30(22)34/h4-5,7-9,11-12,15,19,25-26,36,39H,6,10,13-14,16-17H2,1-3H3,(H,35,40)(H,37,42)/b18-7+/t19-,25+,26+/m0/s1 |
| InChIKey | WSJFGNZXWUOYAI-SWPZBHSGSA-N |
| XLogP | 4.98 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|