C11H20N2O4 — CID 118434025
1,3-bis(ethoxymethyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 118434025) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1,3-bis(ethoxymethyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis(ethoxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118434025 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1,3-bis(ethoxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCOCN1C(=O)N(COCC)C(C)(C)C1=O |
| InChI | InChI=1S/C11H20N2O4/c1-5-16-7-12-9(14)11(3,4)13(10(12)15)8-17-6-2/h5-8H2,1-4H3 |
| InChIKey | LAKLCOMRZUCTMD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|