C27H20N2O5 — CID 118434153
1-[[4-(1,2-oxazol-5-yl)phenyl]methyl]spiro[2H-indole-3,8'-7H-furo[2,3-g][1,4]benzodioxine]-2'-one (PubChem CID 118434153) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 1-[[4-(1,2-oxazol-5-yl)phenyl]methyl]spiro[2H-indole-3,8'-7H-furo[2,3-g][1,4]benzodioxine]-2'-one.
| Compound Name | 1-[[4-(1,2-oxazol-5-yl)phenyl]methyl]spiro[2H-indole-3,8'-7H-furo[2,3-g][1,4]benzodioxine]-2'-one |
|---|---|
| PubChem CID | 118434153 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-[[4-(1,2-oxazol-5-yl)phenyl]methyl]spiro[2H-indole-3,8'-7H-furo[2,3-g][1,4]benzodioxine]-2'-one |
| SMILES | O=C1COc2cc3c(cc2O1)C1(CO3)CN(Cc2ccc(-c3ccno3)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H20N2O5/c30-26-14-31-24-12-23-20(11-25(24)33-26)27(16-32-23)15-29(21-4-2-1-3-19(21)27)13-17-5-7-18(8-6-17)22-9-10-28-34-22/h1-12H,13-16H2 |
| InChIKey | DDVKKZHNXBYXSG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|