ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate

C9H8ClF2NO2 — CID 118434268

IUPACethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate
SMILESCCOC(=O)c1ncc(C(F)F)cc1Cl
InChIInChI=1S/C9H8ClF2NO2/c1-2-15-9(14)7-6(10)3-5(4-13-7)8(11)12/h3-4,8H,2H2,1H3
InChIKeyFCKUBRRFBRDHLV-UHFFFAOYSA-N
MW235.62 g/mol
LogP2.85
Rot. Bonds3

About ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate

ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate (PubChem CID 118434268) has the molecular formula C9H8ClF2NO2 and a molecular weight of 235.62 g/mol. Its IUPAC name is ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate.

Molecular Properties

Compound Nameethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate
PubChem CID118434268
Molecular FormulaC9H8ClF2NO2
Molecular Weight235.62 g/mol
Exact Mass235.02
IUPAC Nameethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate
SMILESCCOC(=O)c1ncc(C(F)F)cc1Cl
InChIInChI=1S/C9H8ClF2NO2/c1-2-15-9(14)7-6(10)3-5(4-13-7)8(11)12/h3-4,8H,2H2,1H3
InChIKeyFCKUBRRFBRDHLV-UHFFFAOYSA-N
XLogP2.85
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.62
LogP ≤ 52.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate?
The IUPAC name of ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate (CID 118434268) is ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate.
What is the SMILES notation for ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate?
The canonical SMILES for ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate is CCOC(=O)c1ncc(C(F)F)cc1Cl.
What is the InChIKey of ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate?
The InChIKey is FCKUBRRFBRDHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF2NO2/c1-2-15-9(14)7-6(10)3-5(4-13-7)8(11)12/h3-4,8H,2H2,1H3.
What are the key properties of ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate?
ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate has a molecular weight of 235.62 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate is sourced from PubChem (CID 118434268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).