C25H21ClN2O3 — CID 11843432
4-(2-chlorophenyl)-9-hydroxy-6-(3-methylbutyl)pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 11843432) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-9-hydroxy-6-(3-methylbutyl)pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 4-(2-chlorophenyl)-9-hydroxy-6-(3-methylbutyl)pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 11843432 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-(2-chlorophenyl)-9-hydroxy-6-(3-methylbutyl)pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | CC(C)CCn1c2ccc(O)cc2c2c3c(c(-c4ccccc4Cl)cc21)C(=O)NC3=O |
| InChI | InChI=1S/C25H21ClN2O3/c1-13(2)9-10-28-19-8-7-14(29)11-17(19)21-20(28)12-16(15-5-3-4-6-18(15)26)22-23(21)25(31)27-24(22)30/h3-8,11-13,29H,9-10H2,1-2H3,(H,27,30,31) |
| InChIKey | DDMDDWMWTMOXPE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|