C18H18N6O2S2 — CID 118435404
N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-cyanopyridine-2-carboxamide (PubChem CID 118435404) has the molecular formula C18H18N6O2S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 118435404 |
| Molecular Formula | C18H18N6O2S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-cyanopyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@H]2CSC(N)=NC2(c2nc(NC(=O)c3ccc(C#N)cn3)cs2)CO1 |
| InChI | InChI=1S/C18H18N6O2S2/c1-10-4-12-7-28-17(20)24-18(12,9-26-10)16-23-14(8-27-16)22-15(25)13-3-2-11(5-19)6-21-13/h2-3,6,8,10,12H,4,7,9H2,1H3,(H2,20,24)(H,22,25)/t10-,12-,18?/m0/s1 |
| InChIKey | TYNXFCODUDWTAD-NTMPORJMSA-N |
| XLogP | 2.34 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |