C19H21F2N5O3S2 — CID 118435495
N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(1,1-difluoroethoxy)pyridine-2-carboxamide (PubChem CID 118435495) has the molecular formula C19H21F2N5O3S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(1,1-difluoroethoxy)pyridine-2-carboxamide.
| Compound Name | N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(1,1-difluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118435495 |
| Molecular Formula | C19H21F2N5O3S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(1,1-difluoroethoxy)pyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@H]2CSC(N)=N[C@@]2(c2nc(NC(=O)c3ccc(OC(C)(F)F)cn3)cs2)CO1 |
| InChI | InChI=1S/C19H21F2N5O3S2/c1-10-5-11-7-31-17(22)26-19(11,9-28-10)16-25-14(8-30-16)24-15(27)13-4-3-12(6-23-13)29-18(2,20)21/h3-4,6,8,10-11H,5,7,9H2,1-2H3,(H2,22,26)(H,24,27)/t10-,11-,19-/m0/s1 |
| InChIKey | VDCUDRLINVFMIC-ADWYPQAOSA-N |
| XLogP | 3.46 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |