C17H19FN2O4 — CID 118435884
6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylic acid (PubChem CID 118435884) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylic acid.
| Compound Name | 6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 118435884 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-(4-fluorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylic acid |
| SMILES | CC1C(=O)N2C(CC(C)(C(=O)O)C2c2ccc(F)cc2)C(=O)N1C |
| InChI | InChI=1S/C17H19FN2O4/c1-9-14(21)20-12(15(22)19(9)3)8-17(2,16(23)24)13(20)10-4-6-11(18)7-5-10/h4-7,9,12-13H,8H2,1-3H3,(H,23,24) |
| InChIKey | DCPKHYKNGLWMRU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |