C17H15Cl2N3O2S2 — CID 118435887
(1S,3S,4S,7S)-4-(3,4-dichlorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile (PubChem CID 118435887) has the molecular formula C17H15Cl2N3O2S2 and a molecular weight of 428.37 g/mol. Its IUPAC name is (1S,3S,4S,7S)-4-(3,4-dichlorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile.
| Compound Name | (1S,3S,4S,7S)-4-(3,4-dichlorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
|---|---|
| PubChem CID | 118435887 |
| Molecular Formula | C17H15Cl2N3O2S2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | (1S,3S,4S,7S)-4-(3,4-dichlorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
| SMILES | CN1C(=O)[C@@]23C[C@](C)(C#N)[C@H](c4ccc(Cl)c(Cl)c4)N2C(=O)[C@]1(C)SS3 |
| InChI | InChI=1S/C17H15Cl2N3O2S2/c1-15(8-20)7-17-14(24)21(3)16(2,25-26-17)13(23)22(17)12(15)9-4-5-10(18)11(19)6-9/h4-6,12H,7H2,1-3H3/t12-,15+,16-,17-/m0/s1 |
| InChIKey | LBXBGAVTEQBTLI-IEAZIUSSSA-N |
| XLogP | 4.08 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|