C17H17FN2O4S2 — CID 118435922
(1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylic acid (PubChem CID 118435922) has the molecular formula C17H17FN2O4S2 and a molecular weight of 396.47 g/mol. Its IUPAC name is (1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylic acid.
| Compound Name | (1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylic acid |
|---|---|
| PubChem CID | 118435922 |
| Molecular Formula | C17H17FN2O4S2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylic acid |
| SMILES | CN1C(=O)[C@@]23C[C@](C)(C(=O)O)[C@H](c4ccc(F)cc4)N2C(=O)[C@]1(C)SS3 |
| InChI | InChI=1S/C17H17FN2O4S2/c1-15(14(23)24)8-17-13(22)19(3)16(2,25-26-17)12(21)20(17)11(15)9-4-6-10(18)7-5-9/h4-7,11H,8H2,1-3H3,(H,23,24)/t11-,15-,16-,17-/m0/s1 |
| InChIKey | QYHWXFCJEPIJRM-SPOWBLRKSA-N |
| XLogP | 2.47 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|