About (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate
(9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate (PubChem CID 118436216) has the molecular formula C16H18FN3O3
and a molecular weight of 319.34 g/mol. Its IUPAC name is (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
| PubChem CID | 118436216 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
| SMILES | CN1C2COCC1CC(OC(=O)c1c[nH]c3c(F)nccc13)C2 |
| InChI | InChI=1S/C16H18FN3O3/c1-20-9-4-11(5-10(20)8-22-7-9)23-16(21)13-6-19-14-12(13)2-3-18-15(14)17/h2-3,6,9-11,19H,4-5,7-8H2,1H3 |
| InChIKey | HLGQZYJUUBWWEB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate?
The IUPAC name of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate (CID 118436216) is (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate.
What is the SMILES notation for (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate?
The canonical SMILES for (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate is CN1C2COCC1CC(OC(=O)c1c[nH]c3c(F)nccc13)C2.
What is the InChIKey of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate?
The InChIKey is HLGQZYJUUBWWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FN3O3/c1-20-9-4-11(5-10(20)8-22-7-9)23-16(21)13-6-19-14-12(13)2-3-18-15(14)17/h2-3,6,9-11,19H,4-5,7-8H2,1H3.
What are the key properties of (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate?
(9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate has a molecular weight of 319.34 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl) 7-fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate is sourced from PubChem (CID 118436216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).