C20H20F6N2O4 — CID 118436473
[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] 1-(2,2,2-trifluoroethyl)indole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 118436473) has the molecular formula C20H20F6N2O4 and a molecular weight of 466.38 g/mol. Its IUPAC name is [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] 1-(2,2,2-trifluoroethyl)indole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] 1-(2,2,2-trifluoroethyl)indole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118436473 |
| Molecular Formula | C20H20F6N2O4 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] 1-(2,2,2-trifluoroethyl)indole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OC1C[C@H]2CC[C@@H](C1)N2)c1cn(CC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C18H19F3N2O2.C2HF3O2/c19-18(20,21)10-23-9-15(14-3-1-2-4-16(14)23)17(24)25-13-7-11-5-6-12(8-13)22-11;3-2(4,5)1(6)7/h1-4,9,11-13,22H,5-8,10H2;(H,6,7)/t11-,12+,13?; |
| InChIKey | YWJJOIXBHPQJSM-KOQCZNHOSA-N |
| XLogP | 4.28 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |