C20H30OSe — CID 11843658
(1R,3R,4R,6S)-3-(2-methoxy-2-phenylpropyl)selanyl-4,7,7-trimethylbicyclo[4.1.0]heptane (PubChem CID 11843658) has the molecular formula C20H30OSe and a molecular weight of 365.42 g/mol. Its IUPAC name is (1R,3R,4R,6S)-3-(2-methoxy-2-phenylpropyl)selanyl-4,7,7-trimethylbicyclo[4.1.0]heptane.
| Compound Name | (1R,3R,4R,6S)-3-(2-methoxy-2-phenylpropyl)selanyl-4,7,7-trimethylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 11843658 |
| Molecular Formula | C20H30OSe |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (1R,3R,4R,6S)-3-(2-methoxy-2-phenylpropyl)selanyl-4,7,7-trimethylbicyclo[4.1.0]heptane |
| SMILES | COC(C)(C[Se][C@@H]1C[C@@H]2[C@H](CC1C)C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H30OSe/c1-14-11-16-17(19(16,2)3)12-18(14)22-13-20(4,21-5)15-9-7-6-8-10-15/h6-10,14,16-18H,11-13H2,1-5H3/t14?,16-,17+,18+,20?/m0/s1 |
| InChIKey | BKSHDPIESINOEX-KTHLUNLYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|