About 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid
2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid (PubChem CID 118436924) has the molecular formula C8H8N4O4
and a molecular weight of 224.18 g/mol. Its IUPAC name is 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid |
| PubChem CID | 118436924 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid |
| SMILES | Cn1c(=O)[nH]c2c(=O)n(CC(=O)O)cnc21 |
| InChI | InChI=1S/C8H8N4O4/c1-11-6-5(10-8(11)16)7(15)12(3-9-6)2-4(13)14/h3H,2H2,1H3,(H,10,16)(H,13,14) |
| InChIKey | LQXPHOXRLWWOFH-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid?
The IUPAC name of 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid (CID 118436924) is 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid.
What is the SMILES notation for 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid?
The canonical SMILES for 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid is Cn1c(=O)[nH]c2c(=O)n(CC(=O)O)cnc21.
What is the InChIKey of 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid?
The InChIKey is LQXPHOXRLWWOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O4/c1-11-6-5(10-8(11)16)7(15)12(3-9-6)2-4(13)14/h3H,2H2,1H3,(H,10,16)(H,13,14).
What are the key properties of 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid?
2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid has a molecular weight of 224.18 g/mol, XLogP of -1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-methyl-6,8-dioxo-7H-purin-1-yl)acetic acid is sourced from PubChem (CID 118436924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).