About 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid
3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid (PubChem CID 118437070) has the molecular formula C26H27NO5
and a molecular weight of 433.50 g/mol. Its IUPAC name is 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid |
| PubChem CID | 118437070 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid |
| SMILES | Cc1c(OCc2cccc(-c3cccc(C(=O)O)c3)n2)ccc(C(=O)CC(C)(C)C)c1O |
| InChI | InChI=1S/C26H27NO5/c1-16-23(12-11-20(24(16)29)22(28)14-26(2,3)4)32-15-19-9-6-10-21(27-19)17-7-5-8-18(13-17)25(30)31/h5-13,29H,14-15H2,1-4H3,(H,30,31) |
| InChIKey | KBWITFULHXQWHN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid?
The IUPAC name of 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid (CID 118437070) is 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid.
What is the SMILES notation for 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid?
The canonical SMILES for 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid is Cc1c(OCc2cccc(-c3cccc(C(=O)O)c3)n2)ccc(C(=O)CC(C)(C)C)c1O.
What is the InChIKey of 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid?
The InChIKey is KBWITFULHXQWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO5/c1-16-23(12-11-20(24(16)29)22(28)14-26(2,3)4)32-15-19-9-6-10-21(27-19)17-7-5-8-18(13-17)25(30)31/h5-13,29H,14-15H2,1-4H3,(H,30,31).
What are the key properties of 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid?
3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid has a molecular weight of 433.50 g/mol, XLogP of 5.66, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]-2-pyridinyl]benzoic acid is sourced from PubChem (CID 118437070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).