About (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate
(3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate (PubChem CID 118437129) has the molecular formula C14H24O3S
and a molecular weight of 272.41 g/mol. Its IUPAC name is (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate.
Molecular Properties
| Compound Name | (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate |
| PubChem CID | 118437129 |
| Molecular Formula | C14H24O3S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate |
| SMILES | CC(=O)OCCC(C)(CCC=C(C)C)SC(C)=O |
| InChI | InChI=1S/C14H24O3S/c1-11(2)7-6-8-14(5,18-13(4)16)9-10-17-12(3)15/h7H,6,8-10H2,1-5H3 |
| InChIKey | VLBYLLRHKGBNLU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate?
The IUPAC name of (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate (CID 118437129) is (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate.
What is the SMILES notation for (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate?
The canonical SMILES for (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate is CC(=O)OCCC(C)(CCC=C(C)C)SC(C)=O.
What is the InChIKey of (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate?
The InChIKey is VLBYLLRHKGBNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3S/c1-11(2)7-6-8-14(5,18-13(4)16)9-10-17-12(3)15/h7H,6,8-10H2,1-5H3.
What are the key properties of (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate?
(3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate has a molecular weight of 272.41 g/mol, XLogP of 3.72, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetylsulfanyl-3,7-dimethyloct-6-enyl) acetate is sourced from PubChem (CID 118437129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).