About 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol
4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol (PubChem CID 118437175) has the molecular formula C10H16OS
and a molecular weight of 184.30 g/mol. Its IUPAC name is 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol.
Molecular Properties
| Compound Name | 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol |
| PubChem CID | 118437175 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol |
| SMILES | CC(C)=C/C=C/C1(C)CC(O)S1 |
| InChI | InChI=1S/C10H16OS/c1-8(2)5-4-6-10(3)7-9(11)12-10/h4-6,9,11H,7H2,1-3H3/b6-4+ |
| InChIKey | BSXGXORJHAAZNH-GQCTYLIASA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol?
The IUPAC name of 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol (CID 118437175) is 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol.
What is the SMILES notation for 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol?
The canonical SMILES for 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol is CC(C)=C/C=C/C1(C)CC(O)S1.
What is the InChIKey of 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol?
The InChIKey is BSXGXORJHAAZNH-GQCTYLIASA-N. The full InChI is InChI=1S/C10H16OS/c1-8(2)5-4-6-10(3)7-9(11)12-10/h4-6,9,11H,7H2,1-3H3/b6-4+.
What are the key properties of 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol?
4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol has a molecular weight of 184.30 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-[(1E)-4-methylpenta-1,3-dienyl]thietan-2-ol is sourced from PubChem (CID 118437175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).