About 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid
2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid (PubChem CID 118437204) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is 2-(1-hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid |
| PubChem CID | 118437204 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-(1-hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid |
| SMILES | CC(=CCCC(C)(CCO)SCC(=O)O)C |
| InChI | InChI=1S/C12H22O3S/c1-10(2)5-4-6-12(3,7-8-13)16-9-11(14)15/h5,13H,4,6-9H2,1-3H3,(H,14,15) |
| InChIKey | QMWINNLIKQMPMW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | 247 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid?
The IUPAC name of 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid (CID 118437204) is 2-(1-hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid.
What is the SMILES notation for 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid?
The canonical SMILES for 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid is CC(=CCCC(C)(CCO)SCC(=O)O)C.
What is the InChIKey of 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid?
The InChIKey is QMWINNLIKQMPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3S/c1-10(2)5-4-6-12(3,7-8-13)16-9-11(14)15/h5,13H,4,6-9H2,1-3H3,(H,14,15).
What are the key properties of 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid?
2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid has a molecular weight of 246.37 g/mol, XLogP of 2.70, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-Hydroxy-3,7-dimethyloct-6-en-3-yl)sulfanylacetic acid is sourced from PubChem (CID 118437204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).