C12H24O7 — CID 11843726
(2R,3R,4S)-2,3,4-tris(methoxymethoxy)hex-5-en-1-ol (PubChem CID 11843726) has the molecular formula C12H24O7 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R,3R,4S)-2,3,4-tris(methoxymethoxy)hex-5-en-1-ol.
| Compound Name | (2R,3R,4S)-2,3,4-tris(methoxymethoxy)hex-5-en-1-ol |
|---|---|
| PubChem CID | 11843726 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (2R,3R,4S)-2,3,4-tris(methoxymethoxy)hex-5-en-1-ol |
| SMILES | C=C[C@H](OCOC)[C@@H](OCOC)[C@@H](CO)OCOC |
| InChI | InChI=1S/C12H24O7/c1-5-10(17-7-14-2)12(19-9-16-4)11(6-13)18-8-15-3/h5,10-13H,1,6-9H2,2-4H3/t10-,11+,12+/m0/s1 |
| InChIKey | GAJCGNJJWUZXGB-QJPTWQEYSA-N |
| XLogP | 0.13 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|