About 1,2-dipentylpyrimidine-2,4-diamine
1,2-dipentylpyrimidine-2,4-diamine (PubChem CID 118437446) has the molecular formula C14H28N4
and a molecular weight of 252.41 g/mol. Its IUPAC name is 1,2-dipentylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 1,2-dipentylpyrimidine-2,4-diamine |
| PubChem CID | 118437446 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 1,2-dipentylpyrimidine-2,4-diamine |
| SMILES | CCCCCN1C=CC(N)=NC1(N)CCCCC |
| InChI | InChI=1S/C14H28N4/c1-3-5-7-10-14(16)17-13(15)9-12-18(14)11-8-6-4-2/h9,12H,3-8,10-11,16H2,1-2H3,(H2,15,17) |
| InChIKey | KRSVNEZSKJSZHN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dipentylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dipentylpyrimidine-2,4-diamine?
The IUPAC name of 1,2-dipentylpyrimidine-2,4-diamine (CID 118437446) is 1,2-dipentylpyrimidine-2,4-diamine.
What is the SMILES notation for 1,2-dipentylpyrimidine-2,4-diamine?
The canonical SMILES for 1,2-dipentylpyrimidine-2,4-diamine is CCCCCN1C=CC(N)=NC1(N)CCCCC.
What is the InChIKey of 1,2-dipentylpyrimidine-2,4-diamine?
The InChIKey is KRSVNEZSKJSZHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4/c1-3-5-7-10-14(16)17-13(15)9-12-18(14)11-8-6-4-2/h9,12H,3-8,10-11,16H2,1-2H3,(H2,15,17).
What are the key properties of 1,2-dipentylpyrimidine-2,4-diamine?
1,2-dipentylpyrimidine-2,4-diamine has a molecular weight of 252.41 g/mol, XLogP of 2.56, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dipentylpyrimidine-2,4-diamine is sourced from PubChem (CID 118437446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).