About [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate
[2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate (PubChem CID 118437477) has the molecular formula C15H18F2N2O3S
and a molecular weight of 344.38 g/mol. Its IUPAC name is [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate.
Molecular Properties
| Compound Name | [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate |
| PubChem CID | 118437477 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate |
| SMILES | NC(=O)OC1CC1c1csc(C(=O)NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C15H18F2N2O3S/c16-15(17)3-1-9(2-4-15)19-13(20)12-5-8(7-23-12)10-6-11(10)22-14(18)21/h5,7,9-11H,1-4,6H2,(H2,18,21)(H,19,20) |
| InChIKey | QDCFVXOGODPXFX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate?
The IUPAC name of [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate (CID 118437477) is [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate.
What is the SMILES notation for [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate?
The canonical SMILES for [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate is NC(=O)OC1CC1c1csc(C(=O)NC2CCC(F)(F)CC2)c1.
What is the InChIKey of [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate?
The InChIKey is QDCFVXOGODPXFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2O3S/c16-15(17)3-1-9(2-4-15)19-13(20)12-5-8(7-23-12)10-6-11(10)22-14(18)21/h5,7,9-11H,1-4,6H2,(H2,18,21)(H,19,20).
What are the key properties of [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate?
[2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate has a molecular weight of 344.38 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[5-[(4,4-difluorocyclohexyl)carbamoyl]thiophen-3-yl]cyclopropyl] carbamate is sourced from PubChem (CID 118437477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).