About (dipentylamino)thiourea;thiourea
(dipentylamino)thiourea;thiourea (PubChem CID 118437524) has the molecular formula C12H29N5S2
and a molecular weight of 307.53 g/mol. Its IUPAC name is (dipentylamino)thiourea;thiourea.
Molecular Properties
| Compound Name | (dipentylamino)thiourea;thiourea |
| PubChem CID | 118437524 |
| Molecular Formula | C12H29N5S2 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (dipentylamino)thiourea;thiourea |
| SMILES | CCCCCN(CCCCC)NC(N)=S.NC(N)=S |
| InChI | InChI=1S/C11H25N3S.CH4N2S/c1-3-5-7-9-14(13-11(12)15)10-8-6-4-2;2-1(3)4/h3-10H2,1-2H3,(H3,12,13,15);(H4,2,3,4) |
| InChIKey | FHMIYSIKBWXEKR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (dipentylamino)thiourea;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dipentylamino)thiourea;thiourea?
The IUPAC name of (dipentylamino)thiourea;thiourea (CID 118437524) is (dipentylamino)thiourea;thiourea.
What is the SMILES notation for (dipentylamino)thiourea;thiourea?
The canonical SMILES for (dipentylamino)thiourea;thiourea is CCCCCN(CCCCC)NC(N)=S.NC(N)=S.
What is the InChIKey of (dipentylamino)thiourea;thiourea?
The InChIKey is FHMIYSIKBWXEKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3S.CH4N2S/c1-3-5-7-9-14(13-11(12)15)10-8-6-4-2;2-1(3)4/h3-10H2,1-2H3,(H3,12,13,15);(H4,2,3,4).
What are the key properties of (dipentylamino)thiourea;thiourea?
(dipentylamino)thiourea;thiourea has a molecular weight of 307.53 g/mol, XLogP of 1.61, 9 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (dipentylamino)thiourea;thiourea is sourced from PubChem (CID 118437524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).