About 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide
2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide (PubChem CID 118437758) has the molecular formula C12H11FN2OS
and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide |
| PubChem CID | 118437758 |
| Molecular Formula | C12H11FN2OS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide |
| SMILES | CCc1c(-c2cncs2)ccc(F)c1C(N)=O |
| InChI | InChI=1S/C12H11FN2OS/c1-2-7-8(10-5-15-6-17-10)3-4-9(13)11(7)12(14)16/h3-6H,2H2,1H3,(H2,14,16) |
| InChIKey | GVBSNBPGZRGNLE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide?
The IUPAC name of 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide (CID 118437758) is 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide.
What is the SMILES notation for 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide?
The canonical SMILES for 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide is CCc1c(-c2cncs2)ccc(F)c1C(N)=O.
What is the InChIKey of 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide?
The InChIKey is GVBSNBPGZRGNLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2OS/c1-2-7-8(10-5-15-6-17-10)3-4-9(13)11(7)12(14)16/h3-6H,2H2,1H3,(H2,14,16).
What are the key properties of 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide?
2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide has a molecular weight of 250.30 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-fluoro-3-(1,3-thiazol-5-yl)benzamide is sourced from PubChem (CID 118437758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).