About 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol
5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol (PubChem CID 118437843) has the molecular formula C19H12F2N4O
and a molecular weight of 350.33 g/mol. Its IUPAC name is 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol.
Molecular Properties
| Compound Name | 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol |
| PubChem CID | 118437843 |
| Molecular Formula | C19H12F2N4O |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol |
| SMILES | Nc1ncnc2ccc(-c3cccnc3-c3cc(O)c(F)cc3F)cc12 |
| InChI | InChI=1S/C19H12F2N4O/c20-14-8-15(21)17(26)7-12(14)18-11(2-1-5-23-18)10-3-4-16-13(6-10)19(22)25-9-24-16/h1-9,26H,(H2,22,24,25) |
| InChIKey | WJYGAXDPRXMPSZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol?
The IUPAC name of 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol (CID 118437843) is 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol.
What is the SMILES notation for 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol?
The canonical SMILES for 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol is Nc1ncnc2ccc(-c3cccnc3-c3cc(O)c(F)cc3F)cc12.
What is the InChIKey of 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol?
The InChIKey is WJYGAXDPRXMPSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N4O/c20-14-8-15(21)17(26)7-12(14)18-11(2-1-5-23-18)10-3-4-16-13(6-10)19(22)25-9-24-16/h1-9,26H,(H2,22,24,25).
What are the key properties of 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol?
5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol has a molecular weight of 350.33 g/mol, XLogP of 3.92, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4-aminoquinazolin-6-yl)-2-pyridinyl]-2,4-difluorophenol is sourced from PubChem (CID 118437843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).