About 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine
3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine (PubChem CID 118438539) has the molecular formula C11H13ClF3N3
and a molecular weight of 279.69 g/mol. Its IUPAC name is 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine |
| PubChem CID | 118438539 |
| Molecular Formula | C11H13ClF3N3 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine |
| SMILES | C[C@H]1CCC[C@@H]1Nc1ncc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C11H13ClF3N3/c1-6-3-2-4-7(6)17-10-9(12)18-8(5-16-10)11(13,14)15/h5-7H,2-4H2,1H3,(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | PRFCQDHXDKGHAL-BQBZGAKWSA-N |
| XLogP | 3.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine?
The IUPAC name of 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine (CID 118438539) is 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine.
What is the SMILES notation for 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine?
The canonical SMILES for 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine is C[C@H]1CCC[C@@H]1Nc1ncc(C(F)(F)F)nc1Cl.
What is the InChIKey of 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine?
The InChIKey is PRFCQDHXDKGHAL-BQBZGAKWSA-N. The full InChI is InChI=1S/C11H13ClF3N3/c1-6-3-2-4-7(6)17-10-9(12)18-8(5-16-10)11(13,14)15/h5-7H,2-4H2,1H3,(H,16,17)/t6-,7-/m0/s1.
What are the key properties of 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine?
3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine has a molecular weight of 279.69 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(1S,2S)-2-methylcyclopentyl]-5-(trifluoromethyl)pyrazin-2-amine is sourced from PubChem (CID 118438539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).