About (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine
(E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine (PubChem CID 118438577) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine |
| PubChem CID | 118438577 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine |
| SMILES | CC/C(=C(/C)CN)N(C)CC |
| InChI | InChI=1S/C9H20N2/c1-5-9(8(3)7-10)11(4)6-2/h5-7,10H2,1-4H3/b9-8+ |
| InChIKey | FRUBIZJSICIZCY-CMDGGOBGSA-N |
| XLogP | 1.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine?
The IUPAC name of (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine (CID 118438577) is (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine.
What is the SMILES notation for (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine?
The canonical SMILES for (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine is CC/C(=C(/C)CN)N(C)CC.
What is the InChIKey of (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine?
The InChIKey is FRUBIZJSICIZCY-CMDGGOBGSA-N. The full InChI is InChI=1S/C9H20N2/c1-5-9(8(3)7-10)11(4)6-2/h5-7,10H2,1-4H3/b9-8+.
What are the key properties of (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine?
(E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine has a molecular weight of 156.27 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-N-ethyl-3-N,2-dimethylpent-2-ene-1,3-diamine is sourced from PubChem (CID 118438577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).