C23H29F3N8O3 — CID 118438588
N-[3-[5-(diaminomethylideneamino)pentanoylamino]-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-6-methylpyrimidine-4-carboxamide (PubChem CID 118438588) has the molecular formula C23H29F3N8O3 and a molecular weight of 522.53 g/mol. Its IUPAC name is N-[3-[5-(diaminomethylideneamino)pentanoylamino]-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[3-[5-(diaminomethylideneamino)pentanoylamino]-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 118438588 |
| Molecular Formula | C23H29F3N8O3 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[3-[5-(diaminomethylideneamino)pentanoylamino]-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(C(F)(F)F)cc(NC(=O)CCCCN=C(N)N)c2OC2CCNC2)ncn1 |
| InChI | InChI=1S/C23H29F3N8O3/c1-13-8-18(32-12-31-13)21(36)34-17-10-14(23(24,25)26)9-16(20(17)37-15-5-7-29-11-15)33-19(35)4-2-3-6-30-22(27)28/h8-10,12,15,29H,2-7,11H2,1H3,(H,33,35)(H,34,36)(H4,27,28,30) |
| InChIKey | LOBLIXRRSWZQLT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 169.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|