C25H41IO2 — CID 118439709
(3R,5S,6R,10S,13R,17R)-6-ethyl-3-hydroxy-17-[(2R)-4-iodobutan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one (PubChem CID 118439709) has the molecular formula C25H41IO2 and a molecular weight of 500.51 g/mol. Its IUPAC name is (3R,5S,6R,10S,13R,17R)-6-ethyl-3-hydroxy-17-[(2R)-4-iodobutan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | (3R,5S,6R,10S,13R,17R)-6-ethyl-3-hydroxy-17-[(2R)-4-iodobutan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 118439709 |
| Molecular Formula | C25H41IO2 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (3R,5S,6R,10S,13R,17R)-6-ethyl-3-hydroxy-17-[(2R)-4-iodobutan-2-yl]-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-one |
| SMILES | CC[C@H]1C(=O)C2C3CC[C@H]([C@H](C)CCI)[C@@]3(C)CCC2[C@@]2(C)CC[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C25H41IO2/c1-5-17-21-14-16(27)8-11-25(21,4)20-9-12-24(3)18(15(2)10-13-26)6-7-19(24)22(20)23(17)28/h15-22,27H,5-14H2,1-4H3/t15-,16-,17-,18-,19?,20?,21+,22?,24-,25-/m1/s1 |
| InChIKey | LFTHDEMAZNJSTI-SUOKYAQWSA-N |
| XLogP | 6.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|