C15H24BrClO2 — CID 11843978
(1S,3S,4S)-4-bromo-3-chloro-1-(5-hydroxy-6-methylhepta-1,6-dien-2-yl)-4-methylcyclohexan-1-ol (PubChem CID 11843978) has the molecular formula C15H24BrClO2 and a molecular weight of 351.71 g/mol. Its IUPAC name is (1S,3S,4S)-4-bromo-3-chloro-1-(5-hydroxy-6-methylhepta-1,6-dien-2-yl)-4-methylcyclohexan-1-ol.
| Compound Name | (1S,3S,4S)-4-bromo-3-chloro-1-(5-hydroxy-6-methylhepta-1,6-dien-2-yl)-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11843978 |
| Molecular Formula | C15H24BrClO2 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1S,3S,4S)-4-bromo-3-chloro-1-(5-hydroxy-6-methylhepta-1,6-dien-2-yl)-4-methylcyclohexan-1-ol |
| SMILES | C=C(C)C(O)CCC(=C)[C@]1(O)CC[C@](C)(Br)[C@@H](Cl)C1 |
| InChI | InChI=1S/C15H24BrClO2/c1-10(2)12(18)6-5-11(3)15(19)8-7-14(4,16)13(17)9-15/h12-13,18-19H,1,3,5-9H2,2,4H3/t12?,13-,14-,15-/m0/s1 |
| InChIKey | KCTBLUZWVXTOET-WLUIXCMPSA-N |
| XLogP | 3.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|