C25H39N7O — CID 118439796
4-[[2-(butylamino)-5-[5-[[(3S)-3-methylpiperazin-1-yl]methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 118439796) has the molecular formula C25H39N7O and a molecular weight of 453.64 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-[5-[[(3S)-3-methylpiperazin-1-yl]methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-[5-[[(3S)-3-methylpiperazin-1-yl]methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 118439796 |
| Molecular Formula | C25H39N7O |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 4-[[2-(butylamino)-5-[5-[[(3S)-3-methylpiperazin-1-yl]methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(CN3CCN[C@@H](C)C3)cn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C25H39N7O/c1-3-4-11-27-25-29-15-22(24(31-25)30-20-6-8-21(33)9-7-20)23-10-5-19(14-28-23)17-32-13-12-26-18(2)16-32/h5,10,14-15,18,20-21,26,33H,3-4,6-9,11-13,16-17H2,1-2H3,(H2,27,29,30,31)/t18-,20?,21?/m0/s1 |
| InChIKey | AOILZWVIBHVMLR-PELRDEGISA-N |
| XLogP | 3.26 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|