C26H41N7O — CID 118439828
4-[[2-(butylamino)-5-[5-[(3,5-dimethylpiperazin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 118439828) has the molecular formula C26H41N7O and a molecular weight of 467.66 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-[5-[(3,5-dimethylpiperazin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-[5-[(3,5-dimethylpiperazin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 118439828 |
| Molecular Formula | C26H41N7O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | 4-[[2-(butylamino)-5-[5-[(3,5-dimethylpiperazin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(CN3CC(C)NC(C)C3)cn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C26H41N7O/c1-4-5-12-27-26-29-14-23(25(32-26)31-21-7-9-22(34)10-8-21)24-11-6-20(13-28-24)17-33-15-18(2)30-19(3)16-33/h6,11,13-14,18-19,21-22,30,34H,4-5,7-10,12,15-17H2,1-3H3,(H2,27,29,31,32) |
| InChIKey | DEOQMORRIDRHPD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|