C15H19N3O3 — CID 118440117
(1R,2S,5R)-2-(azidomethyl)-1,5-dihydroxy-2,5,7-trimethylspiro[1H-indene-6,1'-cyclopropane]-4-one (PubChem CID 118440117) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is (1R,2S,5R)-2-(azidomethyl)-1,5-dihydroxy-2,5,7-trimethylspiro[1H-indene-6,1'-cyclopropane]-4-one.
| Compound Name | (1R,2S,5R)-2-(azidomethyl)-1,5-dihydroxy-2,5,7-trimethylspiro[1H-indene-6,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 118440117 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (1R,2S,5R)-2-(azidomethyl)-1,5-dihydroxy-2,5,7-trimethylspiro[1H-indene-6,1'-cyclopropane]-4-one |
| SMILES | CC1=C2C(=C[C@@](C)(CN=[N+]=[N-])[C@@H]2O)C(=O)[C@](C)(O)C12CC2 |
| InChI | InChI=1S/C15H19N3O3/c1-8-10-9(6-13(2,12(10)20)7-17-18-16)11(19)14(3,21)15(8)4-5-15/h6,12,20-21H,4-5,7H2,1-3H3/t12-,13+,14+/m1/s1 |
| InChIKey | NBBUMYUCCXGNBY-RDBSUJKOSA-N |
| XLogP | 2.03 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|